![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Gallagher_ESA_SSA_20160510.pptx | 2024-01-17 14:32 | 15M | |
![[ ]](/icons/layout.gif) | Desai_Large gradual SEPs_Review.pdf | 2016-10-14 10:21 | 15M | |
| Wang_Flare_filament Eruption_Arcade Implosion.pdf | 2016-10-20 10:10 | 14M | |
| Papaioannou_Flares_CMEs_SEPs_correlarions.pdf | 2020-05-15 12:53 | 12M | |
| Papaioannou_Flares_CMEs_SEPs_Catalogue.pdf | 2020-06-01 12:59 | 12M | |
| Dudik_Slipping Reconnection_ Evaporation Implosion Precursors_X1.6 flare .pdf | 2016-03-22 11:23 | 12M | |
| Janvier_Evolution of Flare Ribbons, Electric Currents and QSLs.pdf | 2016-04-26 10:53 | 12M | |
| Hillaris_Interplanetary Type IV Bursts.pdf | 2016-04-28 09:29 | 11M | |
| Raouafi_Coronal Jets_Review.pdf | 2016-07-08 10:53 | 11M | |
| Chernov_News on Zebra Patterns_ Flare Book.pdf | 2016-11-08 09:12 | 9.6M | |
| Francile_Moreton and EUV Waves_X1 flare_CME.pdf | 2016-09-14 13:17 | 9.0M | |
| Chandra_Peculiar Stationary EUV Wave Fronts_2011-05-11.pdf | 2016-03-01 10:07 | 7.2M | |
| Qiu_LDEs_Impulsive or gradual hiating.pdf | 2016-03-19 16:06 | 6.7M | |
| Bain_SEPS_Shock Connectivity_ICME models.pdf | 2016-06-30 10:21 | 6.7M | |
| Couvidat_HMI_Observables Processing.pdf | 2016-06-09 09:35 | 6.4M | |
| Hudson_memoir_white flares.pdf | 2016-06-22 15:55 | 5.8M | |
| Susino_Determination of CME physical parameters.pdf | 2016-09-07 13:33 | 5.7M | |
| Doran_Temporal Evolution of SEP Spectra.pdf | 2016-08-19 07:51 | 5.7M | |
| Jin_CMEs_Long Range Impacts_ApJ.pdf | 2016-03-18 11:12 | 5.7M | |
| Savani_Prediction of Kp and Bz.pdf | 2016-10-29 13:45 | 5.6M | |
| Riley_Inter-Comparison of Magnetograms.pdf | 2016-05-24 15:54 | 5.5M | |
| Howard_CMEs_ Blast Waves from flares.pdf | 2016-06-20 09:41 | 4.7M | |
| Chernouss_Book_AURORA_2016.pdf | 2017-01-10 14:18 | 4.6M | |
| Dissauer_Projection effects in dimmings and EUV wave .pdf | 2016-07-21 17:08 | 4.6M | |
| Grechnev_A Tiny Eruptive Filament _CME genesis_2010-06-13.pdf | 2016-06-17 10:27 | 4.2M | |
| Zhu_2012 July 23 Extreme Storm.pdf | 2016-07-07 09:29 | 4.1M | |
| Eselevich_Initial Formation of an “Impulsive” CME.pdf | 2016-11-08 10:21 | 3.8M | |
| Gopalswamy_2012 July 23_CME_Extreme SEP-energetic storm particle (ESP).pdf | 2016-10-20 10:47 | 3.7M | |
| Webb_CME trailing current sheets.pdf | 2016-11-30 13:00 | 3.7M | |
| Liu_X-Shaped Flares on the Outskirts of AR.pdf | 2016-09-12 09:49 | 3.6M | |
| Salas-Matamoro_CME-related SEP acceleration_EUV_Radio.pdf | 2016-06-03 09:38 | 3.3M | |
| Aschwanden_Global flare energetics_IV-CMEs.pdf | 2016-05-18 12:00 | 3.3M | |
| Еселевич_Начальная стадия импульсного СМЕ.pdf | 2016-11-08 10:28 | 3.2M | |
| Makela_CMEs_ radial speed-expansion speed relation.pdf | 2016-06-16 11:40 | 3.2M | |
| Lefèvre_Solar Data Related to Historical Extreme GMStorms.pdf | 2016-06-01 09:19 | 3.1M | |
| Harra_Characteristics of X-Class Flares and CMEs.pdf | 2016-06-30 11:18 | 3.0M | |
| Gopalswamy_LF Radio Bursts and Space Weather_Review.pdf | 2016-05-10 10:32 | 2.9M | |
| Xue_reconnection filament eruption_release of twist.pdf | 2016-06-23 09:32 | 2.9M | |
| Effenberger_Hard X-rays from partially occulted flares.pdf | 2016-12-12 09:45 | 2.9M | |
| Cheng_Nature of CME-Flare Associated Dimming.pdf | 2016-04-20 11:33 | 2.9M | |
| Pick_CMEs_Build-up and propagation in a complex environment.pdf | 2016-03-17 09:46 | 2.7M | |
| Wan_CME_shock_Formation and Early Evolution.pdf | 2016-05-05 10:15 | 2.7M | |
| Cabello_CMEs_Simultaneous Views of Axial and Lateral Perspectives.pdf | 2016-07-08 10:23 | 2.6M | |
| Mason_Relationship of dimmings to CME speed and mass.pdf | 2016-10-05 11:18 | 2.3M | |
| Richardson_periodicities in 25 MeV SEPs_cycle 24.pdf | 2016-04-13 10:33 | 2.3M | |
| Vennerstrom_Extreme Geomagnetic Storms.pdf | 2016-06-01 09:27 | 2.2M | |
| Chen_Microwave Imaging of posteruptive urrent sheet_10Sep2017.pdf | 2020-06-04 14:32 | 2.2M | |
| Абунин_Пулково_Космическая погода.pdf | 2016-10-25 16:18 | 2.1M | |
| Joshi_Chain Reconnections and Sympathetic Eruptions.pdf | 2016-02-26 09:49 | 2.1M | |
| Jiang_Major Confined Flare in Super Active AR.pdf | 2016-07-01 11:13 | 2.1M | |
| Hu_12 July 2012_ICME Characteristics and Geoeffectiveness.pdf | 2016-07-22 10:03 | 1.9M | |
| Lee_Multiple Eruptions from a Confined Structure.pdf | 2016-09-15 10:15 | 1.9M | |
| Лившиц_Всплытие полей-токи во вспышке.pdf | 2016-04-24 22:36 | 1.9M | |
| Fleishman_A Cold Flare With Delayed Heating.pdf | 2020-07-30 13:25 | 1.8M | |
| Nunez_Assessment of predictions of SEPs spectral hardness by microwaves.pdf | 2019-05-22 11:46 | 1.8M | |
| Kiss_Systematic variations of macrospicule properties.pdf | 2017-01-19 11:00 | 1.8M | |
| Liu_Why is a flare-rich AR CME-poor.pdf | 2016-07-27 10:52 | 1.7M | |
| Nicewicz_CME Classification Based on Their Dynamics.pdf | 2016-05-26 22:10 | 1.7M | |
| Grechnev_GLE_26Dec2001__I_Major LDE with SSRT.pdf | 2016-11-30 13:14 | 1.6M | |
| Nagovitsyn_Two populations of sunspots.pdf | 2016-12-11 11:53 | 1.5M | |
| Long_Nature of Coronal EIT Waves_Review.pdf | 2016-11-18 09:48 | 1.4M | |
| Gopalswamy_CMEs_History and Development.pdf | 2016-02-12 10:39 | 1.2M | |
| Knipp_May 1967_Extreme SpWeather and Extraordinary Responses.pdf | 2016-08-29 12:48 | 1.2M | |
| Mishra_Collision of CMIs .pdf | 2016-07-27 10:39 | 1.2M | |
| Warmuth_Microwave NOBE observations of a coronal wave.pdf | 2016-09-30 10:36 | 1.1M | |
| Fleishman_Narrowband Gyrosynchrotron Bursts.pdf | 2016-05-04 11:50 | 1.1M | |
| Selvakumaran_geoeffectiveness of cycle 24_moderate storms.pdf | 2016-10-19 09:24 | 1.1M | |
| Selvakumara_Reduced geoeffectiveness of cycle 24_moderate storms.pdf | 2016-08-24 16:07 | 1.1M | |
| Grechnev_GLE_26Dec2001_II_Multi-Loop Microwave Sources.pdf | 2016-11-28 09:49 | 1.0M | |
| Temmer_CME Kinematics_Review.pdf | 2016-03-07 11:48 | 1.0M | |
| Kumar_Characteristics_of_radio-loud_CMEs.pdf | 2017-11-21 15:02 | 1.0M | |
| Базилевская_квази2-летка_Солнце_гелиосфера_КЛ.pdf | 2016-12-21 13:48 | 1.0M | |
| Cliver_SEPs_flare versus shock acceleration.pdf | 2016-12-01 09:34 | 888K | |
| Wang_Propagation of a Geoeffective CME_March 15-17 2015.pdf | 2016-07-27 11:12 | 851K | |
| Pevtsov_Solar Physics Research in the Russia_Review.pdf | 2016-06-07 09:50 | 803K | |
| Priest_Eruptive flares_CMEs_Evolution of Magnetic Helicity .pdf | 2016-07-14 10:15 | 708K | |
| Srivastava_MField in Streamer_Kink Wave_EUV Wave.pdf | 2016-06-02 09:47 | 629K | |
| Livshits_Emerging field-Electric current in Flares.pdf | 2016-04-24 22:41 | 517K | |
| Chen_Global coronal waves_Review.pdf | 2016-04-28 10:07 | 471K | |
| Panesar_Jets_minifilaments_MFlux Cancellation.pdf | 2016-10-28 09:53 | 452K | |
| Bobra_Predicting CMEs.pdf | 2016-03-15 11:09 | 402K | |
| Белов_ Вспышки_CMEs_протонные события.docx | 2017-12-13 13:56 | 339K | |
| Moraal_pulse shape of GLEs.pdf | 2016-04-27 12:23 | 299K | |
| Pevtsov_Space weather research and forecast in USA_Review.pdf | 2016-11-09 11:39 | 245K | |
|
|---|